CAS 1149380-69-7 is the registry number for tert-Butyl N-((1R,3S,5S)-8-azabicyclo(3.2.1)octan-3-yl)carbamate hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 5g, 1g.
Tert-butyl N-[(1S,5R)-8-azabicyclo[3.2.1]octan-3-yl]carbamate;hydrochloride (CAS 1149380-69-7) is a chemical compound with the molecular formula C12H23ClN2O2 and a molecular weight of 262.77 g/mol. IUPAC name: tert-butyl N-[(1S,5R)-8-azabicyclo[3.2.1]octan-3-yl]carbamate;hydrochloride. InChIKey: FAJOKGXZZTZLAU-CVLICLBHSA-N.
| Molecular formula | C12H23ClN2O2 |
|---|---|
| Molecular weight | 262.77 g/mol |
| IUPAC name | tert-butyl N-[(1S,5R)-8-azabicyclo[3.2.1]octan-3-yl]carbamate;hydrochloride |
| InChIKey | FAJOKGXZZTZLAU-CVLICLBHSA-N |
| SMILES | CC(C)(C)OC(=O)NC1C[C@H]2CC[C@@H](C1)N2.Cl |
Computed by PubChem (NCBI)