CAS 1150114-27-4 appears in our catalog under these names: tert–Butyl (5–bromo–2,3–difluorophenyl)carbamate, N-BOC 5-bromo-2,3-difluoroaniline, 95%, 95%, tert-Butyl (5-bromo-2,3-difluorophenyl)carbamate, 95%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
Tert-butyl N-(5-bromo-2,3-difluorophenyl)carbamate (CAS 1150114-27-4) is a chemical compound with the molecular formula C11H12BrF2NO2 and a molecular weight of 308.12 g/mol. IUPAC name: tert-butyl N-(5-bromo-2,3-difluorophenyl)carbamate. InChIKey: WAJJWHFSXMLRKP-UHFFFAOYSA-N.
| Molecular formula | C11H12BrF2NO2 |
|---|---|
| Molecular weight | 308.12 g/mol |
| IUPAC name | tert-butyl N-(5-bromo-2,3-difluorophenyl)carbamate |
| InChIKey | WAJJWHFSXMLRKP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=C(C(=CC(=C1)Br)F)F |
Computed by PubChem (NCBI)