Products 2133342-66-0
CAS 2133342-66-0 is the registry number for tert-Butyl (6-bromo-2,3-difluorophenyl)carbamate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl N-(6-bromo-2,3-difluorophenyl)carbamate (CAS 2133342-66-0) is a chemical compound with the molecular formula C11H12BrF2NO2 and a molecular weight of 308.12 g/mol. IUPAC name: tert-butyl N-(6-bromo-2,3-difluorophenyl)carbamate. InChIKey: JUPJLHSXYIXONB-UHFFFAOYSA-N.
| Molecular formula | C11H12BrF2NO2 |
|---|---|
| Molecular weight | 308.12 g/mol |
| IUPAC name | tert-butyl N-(6-bromo-2,3-difluorophenyl)carbamate |
| InChIKey | JUPJLHSXYIXONB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=C(C=CC(=C1F)F)Br |
Computed by PubChem (NCBI)