Products 1286792-96-8
CAS 1286792-96-8 is the registry number for Ethyl 2-(2-amino-3-bromo-5-methylphenyl)-2,2-difluoroacetate, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g, 25g.
Ethyl 2-(2-amino-3-bromo-5-methylphenyl)-2,2-difluoroacetate (CAS 1286792-96-8) is a chemical compound with the molecular formula C11H12BrF2NO2 and a molecular weight of 308.12 g/mol. IUPAC name: ethyl 2-(2-amino-3-bromo-5-methylphenyl)-2,2-difluoroacetate. InChIKey: YMNAGAXQMMRBJI-UHFFFAOYSA-N.
| Molecular formula | C11H12BrF2NO2 |
|---|---|
| Molecular weight | 308.12 g/mol |
| IUPAC name | ethyl 2-(2-amino-3-bromo-5-methylphenyl)-2,2-difluoroacetate |
| InChIKey | YMNAGAXQMMRBJI-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C1=C(C(=CC(=C1)C)Br)N)(F)F |
Computed by PubChem (NCBI)