CAS 2106782-26-5 is the registry number for tert-Butyl (3-bromo-2,4-difluorophenyl)carbamate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl N-(3-bromo-2,4-difluorophenyl)carbamate (CAS 2106782-26-5) is a chemical compound with the molecular formula C11H12BrF2NO2 and a molecular weight of 308.12 g/mol. IUPAC name: tert-butyl N-(3-bromo-2,4-difluorophenyl)carbamate. InChIKey: OSKGTYVKTWBVJZ-UHFFFAOYSA-N.
| Molecular formula | C11H12BrF2NO2 |
|---|---|
| Molecular weight | 308.12 g/mol |
| IUPAC name | tert-butyl N-(3-bromo-2,4-difluorophenyl)carbamate |
| InChIKey | OSKGTYVKTWBVJZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=C(C(=C(C=C1)F)Br)F |
Computed by PubChem (NCBI)