Products 1150560-91-0

CAS 1150560-91-0 is the registry number for 3-Naphthalen-1-ylmethyl-1,3-dihydroindol-2-one, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.

Structural formula: {0} (CAS {1})

3-(naphthalen-1-ylmethyl)-1,3-dihydroindol-2-one (CAS 1150560-91-0) is a chemical compound with the molecular formula C19H15NO and a molecular weight of 273.3 g/mol. IUPAC name: 3-(naphthalen-1-ylmethyl)-1,3-dihydroindol-2-one. InChIKey: GXPRWYRMIPRUNT-UHFFFAOYSA-N.

Identity
Molecular formulaC19H15NO
Molecular weight273.3 g/mol
IUPAC name3-(naphthalen-1-ylmethyl)-1,3-dihydroindol-2-one
InChIKeyGXPRWYRMIPRUNT-UHFFFAOYSA-N
SMILESC1=CC=C2C(=C1)C=CC=C2CC3C4=CC=CC=C4NC3=O

Computed by PubChem (NCBI)