CAS 13234-80-5 is the registry number for N-Phenyl biphenyl-2-carboxamide, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.
N,2-diphenylbenzamide (CAS 13234-80-5) is a chemical compound with the molecular formula C19H15NO and a molecular weight of 273.3 g/mol. IUPAC name: N,2-diphenylbenzamide. InChIKey: JVRMUFJCFLXSMJ-UHFFFAOYSA-N.
| Molecular formula | C19H15NO |
|---|---|
| Molecular weight | 273.3 g/mol |
| IUPAC name | N,2-diphenylbenzamide |
| InChIKey | JVRMUFJCFLXSMJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=CC=C2C(=O)NC3=CC=CC=C3 |
Computed by PubChem (NCBI)