CAS 620987-78-2 is the registry number for 2–(9H–Carbazol–9–yl)–4–methylphenol. Offered by: GLPBio. Available pack sizes: 100mg.
2-carbazol-9-yl-4-methylphenol (CAS 620987-78-2) is a chemical compound with the molecular formula C19H15NO and a molecular weight of 273.3 g/mol. IUPAC name: 2-carbazol-9-yl-4-methylphenol. InChIKey: UKPSQOZZEVCTLS-UHFFFAOYSA-N.
| Molecular formula | C19H15NO |
|---|---|
| Molecular weight | 273.3 g/mol |
| IUPAC name | 2-carbazol-9-yl-4-methylphenol |
| InChIKey | UKPSQOZZEVCTLS-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)O)N2C3=CC=CC=C3C4=CC=CC=C42 |
Computed by PubChem (NCBI)