CAS 91713-53-0 is the registry number for 2-(4-Phenylbenzoyl)aniline. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
(2-aminophenyl)-(4-phenylphenyl)methanone (CAS 91713-53-0) is a chemical compound with the molecular formula C19H15NO and a molecular weight of 273.3 g/mol. IUPAC name: (2-aminophenyl)-(4-phenylphenyl)methanone. InChIKey: ISHRUVAAZLDMKC-UHFFFAOYSA-N.
| Molecular formula | C19H15NO |
|---|---|
| Molecular weight | 273.3 g/mol |
| IUPAC name | (2-aminophenyl)-(4-phenylphenyl)methanone |
| InChIKey | ISHRUVAAZLDMKC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)C(=O)C3=CC=CC=C3N |
Computed by PubChem (NCBI)