CAS 115103-30-5 is the registry number for 3-(2-hydroxy-4-methoxy-6-methylphenoxy)-5-methylbenzene-1,2-diol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(2-hydroxy-4-methoxy-6-methylphenoxy)-5-methylbenzene-1,2-diol (CAS 115103-30-5) is a chemical compound with the molecular formula C15H16O5 and a molecular weight of 276.28 g/mol. IUPAC name: 3-(2-hydroxy-4-methoxy-6-methylphenoxy)-5-methylbenzene-1,2-diol. InChIKey: JGXPRDVSWGDODG-UHFFFAOYSA-N.
| Molecular formula | C15H16O5 |
|---|---|
| Molecular weight | 276.28 g/mol |
| IUPAC name | 3-(2-hydroxy-4-methoxy-6-methylphenoxy)-5-methylbenzene-1,2-diol |
| InChIKey | JGXPRDVSWGDODG-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)OC2=C(C=C(C=C2C)OC)O)O)O |
Computed by PubChem (NCBI)