Products 853892-40-7

CAS 853892-40-7 is the registry number for 2-[(3,4,7-Trimethyl-2-oxo-2h-chromen-5-yl)oxy]propanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

2-(3,4,7-trimethyl-2-oxochromen-5-yl)oxypropanoic acid (CAS 853892-40-7) is a chemical compound with the molecular formula C15H16O5 and a molecular weight of 276.28 g/mol. IUPAC name: 2-(3,4,7-trimethyl-2-oxochromen-5-yl)oxypropanoic acid. InChIKey: KAZIEQWMUFVXSZ-UHFFFAOYSA-N.

Identity
Molecular formulaC15H16O5
Molecular weight276.28 g/mol
IUPAC name2-(3,4,7-trimethyl-2-oxochromen-5-yl)oxypropanoic acid
InChIKeyKAZIEQWMUFVXSZ-UHFFFAOYSA-N
SMILESCC1=CC2=C(C(=C(C(=O)O2)C)C)C(=C1)OC(C)C(=O)O

Computed by PubChem (NCBI)