CAS 843621-27-2 is the registry number for 2-[(4-Ethyl-7-methyl-2-oxo-2h-chromen-5-yl)oxy]propanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
2-(4-ethyl-7-methyl-2-oxochromen-5-yl)oxypropanoic acid (CAS 843621-27-2) is a chemical compound with the molecular formula C15H16O5 and a molecular weight of 276.28 g/mol. IUPAC name: 2-(4-ethyl-7-methyl-2-oxochromen-5-yl)oxypropanoic acid. InChIKey: PPSGPOYIPZNDKA-UHFFFAOYSA-N.
| Molecular formula | C15H16O5 |
|---|---|
| Molecular weight | 276.28 g/mol |
| IUPAC name | 2-(4-ethyl-7-methyl-2-oxochromen-5-yl)oxypropanoic acid |
| InChIKey | PPSGPOYIPZNDKA-UHFFFAOYSA-N |
| SMILES | CCC1=CC(=O)OC2=C1C(=CC(=C2)C)OC(C)C(=O)O |
Computed by PubChem (NCBI)