Products 304896-87-5

CAS 304896-87-5 is the registry number for 2-[(2-Oxo-4-propyl-2h-chromen-7-yl)oxy]propanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

2-(2-oxo-4-propylchromen-7-yl)oxypropanoic acid (CAS 304896-87-5) is a chemical compound with the molecular formula C15H16O5 and a molecular weight of 276.28 g/mol. IUPAC name: 2-(2-oxo-4-propylchromen-7-yl)oxypropanoic acid. InChIKey: ROYPNRGGAUKENS-UHFFFAOYSA-N.

Identity
Molecular formulaC15H16O5
Molecular weight276.28 g/mol
IUPAC name2-(2-oxo-4-propylchromen-7-yl)oxypropanoic acid
InChIKeyROYPNRGGAUKENS-UHFFFAOYSA-N
SMILESCCCC1=CC(=O)OC2=C1C=CC(=C2)OC(C)C(=O)O

Computed by PubChem (NCBI)