CAS 115132-19-9 appears in our catalog under these names: (2R, 3R)/(2S, 3S)-Racemic-boc-beta-methyl-phenylalanine, 98%, (2R, 3R)/(2S, 3S)-Racemic-Boc-beta-methyl-phenylalanine, 95%, rel–(2S,3S)–2–((tert–Butoxycarbonyl)amino)–3–phenylbutanoic acid, Boc-beta-Me-Phe-OH (RR,SS). Offered by: Combi-blocks, AmBeed, GLPBio, Iris Biotech. Available pack sizes: 250mg, 5g, 1g, 100mg.
(2S,3S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylbutanoic acid (CAS 115132-19-9) is a chemical compound with the molecular formula C15H21NO4 and a molecular weight of 279.33 g/mol. IUPAC name: (2S,3S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylbutanoic acid. InChIKey: XFSLNPBJZAPTMM-JQWIXIFHSA-N.
| Molecular formula | C15H21NO4 |
|---|---|
| Molecular weight | 279.33 g/mol |
| IUPAC name | (2S,3S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylbutanoic acid |
| InChIKey | XFSLNPBJZAPTMM-JQWIXIFHSA-N |
| SMILES | C[C@@H](C1=CC=CC=C1)[C@@H](C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)