CAS 321524-48-5 is the registry number for (2R,3S)-2-tert-Butoxycarbonylamino-3-phenyl butyric acid, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 250mg, 1g, 5g.
(2R,3S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylbutanoic acid (CAS 321524-48-5) is a chemical compound with the molecular formula C15H21NO4 and a molecular weight of 279.33 g/mol. IUPAC name: (2R,3S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylbutanoic acid. InChIKey: XFSLNPBJZAPTMM-CMPLNLGQSA-N.
| Molecular formula | C15H21NO4 |
|---|---|
| Molecular weight | 279.33 g/mol |
| IUPAC name | (2R,3S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylbutanoic acid |
| InChIKey | XFSLNPBJZAPTMM-CMPLNLGQSA-N |
| SMILES | C[C@@H](C1=CC=CC=C1)[C@H](C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)