CAS 1152427-93-4 is the registry number for Trans-2-phenylvinylboronic acid mida ester, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 25g, 1g.
6-methyl-2-[(E)-2-phenylethenyl]-1,3,6,2-dioxazaborocane-4,8-dione (CAS 1152427-93-4) is a chemical compound with the molecular formula C13H14BNO4 and a molecular weight of 259.07 g/mol. IUPAC name: 6-methyl-2-[(E)-2-phenylethenyl]-1,3,6,2-dioxazaborocane-4,8-dione. InChIKey: OFLDLTAQNBBGGU-BQYQJAHWSA-N.
| Molecular formula | C13H14BNO4 |
|---|---|
| Molecular weight | 259.07 g/mol |
| IUPAC name | 6-methyl-2-[(E)-2-phenylethenyl]-1,3,6,2-dioxazaborocane-4,8-dione |
| InChIKey | OFLDLTAQNBBGGU-BQYQJAHWSA-N |
| SMILES | B1(OC(=O)CN(CC(=O)O1)C)/C=C/C2=CC=CC=C2 |
Computed by PubChem (NCBI)