Products 1152427-93-4

CAS 1152427-93-4 is the registry number for Trans-2-phenylvinylboronic acid mida ester, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 25g, 1g.

Structural formula: {0} (CAS {1})

6-methyl-2-[(E)-2-phenylethenyl]-1,3,6,2-dioxazaborocane-4,8-dione (CAS 1152427-93-4) is a chemical compound with the molecular formula C13H14BNO4 and a molecular weight of 259.07 g/mol. IUPAC name: 6-methyl-2-[(E)-2-phenylethenyl]-1,3,6,2-dioxazaborocane-4,8-dione. InChIKey: OFLDLTAQNBBGGU-BQYQJAHWSA-N.

Identity
Molecular formulaC13H14BNO4
Molecular weight259.07 g/mol
IUPAC name6-methyl-2-[(E)-2-phenylethenyl]-1,3,6,2-dioxazaborocane-4,8-dione
InChIKeyOFLDLTAQNBBGGU-BQYQJAHWSA-N
SMILESB1(OC(=O)CN(CC(=O)O1)C)/C=C/C2=CC=CC=C2

Computed by PubChem (NCBI)