CAS 1257648-79-5 appears in our catalog under these names: 6-Methyl-2-(4-vinylphenyl)-1,3,6,2-dioxazaborocane-4,8-dione, 98%, 4–Vinylphenylboronic acid MIDA ester, 2-(4-ethenylphenyl)-6-methyl-2,6-dihydro-1,3,6,2-dioxazaborocine-4,8-diol, 97%. Offered by: AmBeed, GLPBio, Fluorochem. Available pack sizes: 1g, 25g, 5g.
2-(4-ethenylphenyl)-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione (CAS 1257648-79-5) is a chemical compound with the molecular formula C13H14BNO4 and a molecular weight of 259.07 g/mol. IUPAC name: 2-(4-ethenylphenyl)-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione. InChIKey: RMGMSNLWDRCFFR-UHFFFAOYSA-N.
| Molecular formula | C13H14BNO4 |
|---|---|
| Molecular weight | 259.07 g/mol |
| IUPAC name | 2-(4-ethenylphenyl)-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione |
| InChIKey | RMGMSNLWDRCFFR-UHFFFAOYSA-N |
| SMILES | B1(OC(=O)CN(CC(=O)O1)C)C2=CC=C(C=C2)C=C |
Computed by PubChem (NCBI)