CAS 1615247-97-6 is the registry number for 1-[2-(4-Boronophenoxy)ethyl]-1,4-dihydropyridin-4-one, 97%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
[4-[2-(4-oxo-1-pyridinyl)ethoxy]phenyl]boronic acid (CAS 1615247-97-6) is a chemical compound with the molecular formula C13H14BNO4 and a molecular weight of 259.07 g/mol. IUPAC name: [4-[2-(4-oxo-1-pyridinyl)ethoxy]phenyl]boronic acid. InChIKey: OOJGGGQHVWIGHJ-UHFFFAOYSA-N.
| Molecular formula | C13H14BNO4 |
|---|---|
| Molecular weight | 259.07 g/mol |
| IUPAC name | [4-[2-(4-oxo-1-pyridinyl)ethoxy]phenyl]boronic acid |
| InChIKey | OOJGGGQHVWIGHJ-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)OCCN2C=CC(=O)C=C2)(O)O |
Computed by PubChem (NCBI)