Products 2096340-20-2

CAS 2096340-20-2 is the registry number for 4-[2-(Pyridin-4-yloxy)ethoxy]phenylboronic acid, 97%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 100mg.

Structural formula: {0} (CAS {1})

[4-(2-pyridin-4-yloxyethoxy)phenyl]boronic acid (CAS 2096340-20-2) is a chemical compound with the molecular formula C13H14BNO4 and a molecular weight of 259.07 g/mol. IUPAC name: [4-(2-pyridin-4-yloxyethoxy)phenyl]boronic acid. InChIKey: ZOCVHKMDBOKPKI-UHFFFAOYSA-N.

Identity
Molecular formulaC13H14BNO4
Molecular weight259.07 g/mol
IUPAC name[4-(2-pyridin-4-yloxyethoxy)phenyl]boronic acid
InChIKeyZOCVHKMDBOKPKI-UHFFFAOYSA-N
SMILESB(C1=CC=C(C=C1)OCCOC2=CC=NC=C2)(O)O

Computed by PubChem (NCBI)