CAS 1152502-56-1 appears in our catalog under these names: 5-Methyl-4-(2,4,6-trifluorophenyl)-1,3-thiazol-2-amine, 95%, 5-Methyl-4-(2,4,6-trifluorophenyl)-1,3-thiazol-2-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
5-methyl-4-(2,4,6-trifluorophenyl)-1,3-thiazol-2-amine (CAS 1152502-56-1) is a chemical compound with the molecular formula C10H7F3N2S and a molecular weight of 244.24 g/mol. IUPAC name: 5-methyl-4-(2,4,6-trifluorophenyl)-1,3-thiazol-2-amine. InChIKey: ZKSHIUGLWZXRKP-UHFFFAOYSA-N.
| Molecular formula | C10H7F3N2S |
|---|---|
| Molecular weight | 244.24 g/mol |
| IUPAC name | 5-methyl-4-(2,4,6-trifluorophenyl)-1,3-thiazol-2-amine |
| InChIKey | ZKSHIUGLWZXRKP-UHFFFAOYSA-N |
| SMILES | CC1=C(N=C(S1)N)C2=C(C=C(C=C2F)F)F |
Computed by PubChem (NCBI)