CAS 25372-17-2 is the registry number for 1-(2-Trifluoromethylphenyl)imidazoline-2-thione. Offered by: Fluorochem. Available pack sizes: 1g.
3-[2-(trifluoromethyl)phenyl]-1H-imidazole-2-thione (CAS 25372-17-2) is a chemical compound with the molecular formula C10H7F3N2S and a molecular weight of 244.24 g/mol. IUPAC name: 3-[2-(trifluoromethyl)phenyl]-1H-imidazole-2-thione. InChIKey: SHEVDRLIPIJLJW-UHFFFAOYSA-N.
| Molecular formula | C10H7F3N2S |
|---|---|
| Molecular weight | 244.24 g/mol |
| IUPAC name | 3-[2-(trifluoromethyl)phenyl]-1H-imidazole-2-thione |
| InChIKey | SHEVDRLIPIJLJW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(F)(F)F)N2C=CNC2=S |
Computed by PubChem (NCBI)