CAS 1498589-74-4 appears in our catalog under these names: 3-(3-(Trifluoromethyl)phenyl)-1,2-thiazol-4-amine, 3-(3-(Trifluoromethyl)phenyl)-1,2-thiazol-4-amine, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 50mg, 0,5g, 1g.
3-[3-(trifluoromethyl)phenyl]-1,2-thiazol-4-amine (CAS 1498589-74-4) is a chemical compound with the molecular formula C10H7F3N2S and a molecular weight of 244.24 g/mol. IUPAC name: 3-[3-(trifluoromethyl)phenyl]-1,2-thiazol-4-amine. InChIKey: UMYYVXZGRFSNLI-UHFFFAOYSA-N.
| Molecular formula | C10H7F3N2S |
|---|---|
| Molecular weight | 244.24 g/mol |
| IUPAC name | 3-[3-(trifluoromethyl)phenyl]-1,2-thiazol-4-amine |
| InChIKey | UMYYVXZGRFSNLI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(F)(F)F)C2=NSC=C2N |
Computed by PubChem (NCBI)