CAS 926188-02-5 is the registry number for 5-((2,3,4-Trifluorophenyl)methyl)-1,3-thiazol-2-amine, 95%. Offered by: AmBeed. Available pack sizes: 5g.
5-[(2,3,4-trifluorophenyl)methyl]-1,3-thiazol-2-amine (CAS 926188-02-5) is a chemical compound with the molecular formula C10H7F3N2S and a molecular weight of 244.24 g/mol. IUPAC name: 5-[(2,3,4-trifluorophenyl)methyl]-1,3-thiazol-2-amine. InChIKey: FCGFLMKPFPJGAV-UHFFFAOYSA-N.
| Molecular formula | C10H7F3N2S |
|---|---|
| Molecular weight | 244.24 g/mol |
| IUPAC name | 5-[(2,3,4-trifluorophenyl)methyl]-1,3-thiazol-2-amine |
| InChIKey | FCGFLMKPFPJGAV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1CC2=CN=C(S2)N)F)F)F |
Computed by PubChem (NCBI)