CAS 1152511-49-3 appears in our catalog under these names: 1-(3-Fluorophenyl)-4-hydroxy-1H-pyrazole-3-carboxylic acid, 1-(3-Fluorophenyl)-4-hydroxy-1h-pyrazole-3-carboxylic acid, 95%. Offered by: Biosynth, Combi-blocks, AmBeed. Available pack sizes: 100mg, 1g, 5g, 10g, 250mg.
1-(3-fluorophenyl)-4-hydroxypyrazole-3-carboxylic acid (CAS 1152511-49-3) is a chemical compound with the molecular formula C10H7FN2O3 and a molecular weight of 222.17 g/mol. IUPAC name: 1-(3-fluorophenyl)-4-hydroxypyrazole-3-carboxylic acid. InChIKey: GNVISLUCVVHPCS-UHFFFAOYSA-N.
| Molecular formula | C10H7FN2O3 |
|---|---|
| Molecular weight | 222.17 g/mol |
| IUPAC name | 1-(3-fluorophenyl)-4-hydroxypyrazole-3-carboxylic acid |
| InChIKey | GNVISLUCVVHPCS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)N2C=C(C(=N2)C(=O)O)O |
Computed by PubChem (NCBI)