CAS 1339354-36-7 appears in our catalog under these names: 5-((2-Fluorophenyl)methyl)-1,2,4-oxadiazole-3-carboxylic acid, 95%, 5-((2-Fluorophenyl)methyl)-1,2,4-oxadiazole-3-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
5-[(2-fluorophenyl)methyl]-1,2,4-oxadiazole-3-carboxylic acid (CAS 1339354-36-7) is a chemical compound with the molecular formula C10H7FN2O3 and a molecular weight of 222.17 g/mol. IUPAC name: 5-[(2-fluorophenyl)methyl]-1,2,4-oxadiazole-3-carboxylic acid. InChIKey: LIZKCXIDMCZIDC-UHFFFAOYSA-N.
| Molecular formula | C10H7FN2O3 |
|---|---|
| Molecular weight | 222.17 g/mol |
| IUPAC name | 5-[(2-fluorophenyl)methyl]-1,2,4-oxadiazole-3-carboxylic acid |
| InChIKey | LIZKCXIDMCZIDC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CC2=NC(=NO2)C(=O)O)F |
Computed by PubChem (NCBI)