Products 1152602-04-4

CAS 1152602-04-4 appears in our catalog under these names: 1-(2-Fluorophenyl)-4-hydroxy-1H-pyrazole-3-carboxylic acid, 95%, 1-(2-Fluorophenyl)-4-hydroxy-1H-pyrazole-3-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.

Structural formula: {0} (CAS {1})

1-(2-fluorophenyl)-4-hydroxypyrazole-3-carboxylic acid (CAS 1152602-04-4) is a chemical compound with the molecular formula C10H7FN2O3 and a molecular weight of 222.17 g/mol. IUPAC name: 1-(2-fluorophenyl)-4-hydroxypyrazole-3-carboxylic acid. InChIKey: LMPBFXBZBGSBLT-UHFFFAOYSA-N.

Identity
Molecular formulaC10H7FN2O3
Molecular weight222.17 g/mol
IUPAC name1-(2-fluorophenyl)-4-hydroxypyrazole-3-carboxylic acid
InChIKeyLMPBFXBZBGSBLT-UHFFFAOYSA-N
SMILESC1=CC=C(C(=C1)N2C=C(C(=N2)C(=O)O)O)F

Computed by PubChem (NCBI)