CAS 1239719-71-1 is the registry number for 5-(2-Fluoro-4-nitrophenyl)-2-methyloxazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-(2-fluoro-4-nitrophenyl)-2-methyl-1,3-oxazole (CAS 1239719-71-1) is a chemical compound with the molecular formula C10H7FN2O3 and a molecular weight of 222.17 g/mol. IUPAC name: 5-(2-fluoro-4-nitrophenyl)-2-methyl-1,3-oxazole. InChIKey: KVUXQTDXIPGTDI-UHFFFAOYSA-N.
| Molecular formula | C10H7FN2O3 |
|---|---|
| Molecular weight | 222.17 g/mol |
| IUPAC name | 5-(2-fluoro-4-nitrophenyl)-2-methyl-1,3-oxazole |
| InChIKey | KVUXQTDXIPGTDI-UHFFFAOYSA-N |
| SMILES | CC1=NC=C(O1)C2=C(C=C(C=C2)[N+](=O)[O-])F |
Computed by PubChem (NCBI)