CAS 1152529-22-0 is the registry number for 2-Benzyl-1,3-benzoxazol-6-amine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-benzyl-1,3-benzoxazol-6-amine (CAS 1152529-22-0) is a chemical compound with the molecular formula C14H12N2O and a molecular weight of 224.26 g/mol. IUPAC name: 2-benzyl-1,3-benzoxazol-6-amine. InChIKey: MYJXYQISQKRASX-UHFFFAOYSA-N.
| Molecular formula | C14H12N2O |
|---|---|
| Molecular weight | 224.26 g/mol |
| IUPAC name | 2-benzyl-1,3-benzoxazol-6-amine |
| InChIKey | MYJXYQISQKRASX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2=NC3=C(O2)C=C(C=C3)N |
Computed by PubChem (NCBI)