CAS 1152533-76-0 appears in our catalog under these names: 1-(2-Chlorophenyl)-1H-pyrazole-3-carboxylic acid, 95%, 1-(2-Chlorophenyl)-1H-pyrazole-3-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 100mg, 500mg, 1000mg.
1-(2-chlorophenyl)pyrazole-3-carboxylic acid (CAS 1152533-76-0) is a chemical compound with the molecular formula C10H7ClN2O2 and a molecular weight of 222.63 g/mol. IUPAC name: 1-(2-chlorophenyl)pyrazole-3-carboxylic acid. InChIKey: XVUVNZVHZHYLFI-UHFFFAOYSA-N.
| Molecular formula | C10H7ClN2O2 |
|---|---|
| Molecular weight | 222.63 g/mol |
| IUPAC name | 1-(2-chlorophenyl)pyrazole-3-carboxylic acid |
| InChIKey | XVUVNZVHZHYLFI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)N2C=CC(=N2)C(=O)O)Cl |
Computed by PubChem (NCBI)