Products 1152584-11-6
CAS 1152584-11-6 is the registry number for 3-Ethyl-3-(4-methylphenyl)pyrrolidine-2,5-dione. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-ethyl-3-(4-methylphenyl)pyrrolidine-2,5-dione (CAS 1152584-11-6) is a chemical compound with the molecular formula C13H15NO2 and a molecular weight of 217.26 g/mol. IUPAC name: 3-ethyl-3-(4-methylphenyl)pyrrolidine-2,5-dione. InChIKey: IOHDQQKVEJHTAZ-UHFFFAOYSA-N.
| Molecular formula | C13H15NO2 |
|---|---|
| Molecular weight | 217.26 g/mol |
| IUPAC name | 3-ethyl-3-(4-methylphenyl)pyrrolidine-2,5-dione |
| InChIKey | IOHDQQKVEJHTAZ-UHFFFAOYSA-N |
| SMILES | CCC1(CC(=O)NC1=O)C2=CC=C(C=C2)C |
Computed by PubChem (NCBI)