CAS 1152604-97-1 appears in our catalog under these names: 2-(1-Benzofuran-2-yl)-1,3-thiazole-4-carboxylic acid, 95%, 2-(1-Benzofuran-2-yl)-1,3-thiazole-4-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
2-(1-benzofuran-2-yl)-1,3-thiazole-4-carboxylic acid (CAS 1152604-97-1) is a chemical compound with the molecular formula C12H7NO3S and a molecular weight of 245.26 g/mol. IUPAC name: 2-(1-benzofuran-2-yl)-1,3-thiazole-4-carboxylic acid. InChIKey: NHGSNHLPFXYDOB-UHFFFAOYSA-N.
| Molecular formula | C12H7NO3S |
|---|---|
| Molecular weight | 245.26 g/mol |
| IUPAC name | 2-(1-benzofuran-2-yl)-1,3-thiazole-4-carboxylic acid |
| InChIKey | NHGSNHLPFXYDOB-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(O2)C3=NC(=CS3)C(=O)O |
Computed by PubChem (NCBI)