CAS 32277-89-7 is the registry number for 5-(1,3-Benzothiazol-2-yl)furan-2-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5-(1,3-benzothiazol-2-yl)furan-2-carboxylic acid (CAS 32277-89-7) is a chemical compound with the molecular formula C12H7NO3S and a molecular weight of 245.26 g/mol. IUPAC name: 5-(1,3-benzothiazol-2-yl)furan-2-carboxylic acid. InChIKey: WMCXRJZXJIMEPS-UHFFFAOYSA-N.
| Molecular formula | C12H7NO3S |
|---|---|
| Molecular weight | 245.26 g/mol |
| IUPAC name | 5-(1,3-benzothiazol-2-yl)furan-2-carboxylic acid |
| InChIKey | WMCXRJZXJIMEPS-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C(S2)C3=CC=C(O3)C(=O)O |
Computed by PubChem (NCBI)