CAS 881375-77-5 is the registry number for 1-Nitrodibenzo[b,d]thiophen-4-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-nitrodibenzothiophen-4-ol (CAS 881375-77-5) is a chemical compound with the molecular formula C12H7NO3S and a molecular weight of 245.26 g/mol. IUPAC name: 1-nitrodibenzothiophen-4-ol. InChIKey: LYQUQDLMNPGFSS-UHFFFAOYSA-N.
| Molecular formula | C12H7NO3S |
|---|---|
| Molecular weight | 245.26 g/mol |
| IUPAC name | 1-nitrodibenzothiophen-4-ol |
| InChIKey | LYQUQDLMNPGFSS-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(C=CC(=C3S2)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)