Products 1431935-37-3

CAS 1431935-37-3 is the registry number for 5-(Benzo[b]thiophen-2-yl)isoxazole-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

5-(1-benzothiophen-2-yl)-1,2-oxazole-3-carboxylic acid (CAS 1431935-37-3) is a chemical compound with the molecular formula C12H7NO3S and a molecular weight of 245.26 g/mol. IUPAC name: 5-(1-benzothiophen-2-yl)-1,2-oxazole-3-carboxylic acid. InChIKey: JPKWWBWALIUNTH-UHFFFAOYSA-N.

Identity
Molecular formulaC12H7NO3S
Molecular weight245.26 g/mol
IUPAC name5-(1-benzothiophen-2-yl)-1,2-oxazole-3-carboxylic acid
InChIKeyJPKWWBWALIUNTH-UHFFFAOYSA-N
SMILESC1=CC=C2C(=C1)C=C(S2)C3=CC(=NO3)C(=O)O

Computed by PubChem (NCBI)