Products 1152665-00-3
CAS 1152665-00-3 is the registry number for 5-cyclopropyl-2-(1,1-dioxothiolan-3-yl)pyrazol-3-amine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-cyclopropyl-1-(1,1-dioxothiolan-3-yl)pyrazol-5-amine (CAS 1152665-00-3) is a chemical compound with the molecular formula C10H15N3O2S and a molecular weight of 241.31 g/mol. IUPAC name: 3-cyclopropyl-1-(1,1-dioxothiolan-3-yl)pyrazol-5-amine. InChIKey: ROABRKHMKPWAMM-UHFFFAOYSA-N.
| Molecular formula | C10H15N3O2S |
|---|---|
| Molecular weight | 241.31 g/mol |
| IUPAC name | 3-cyclopropyl-1-(1,1-dioxothiolan-3-yl)pyrazol-5-amine |
| InChIKey | ROABRKHMKPWAMM-UHFFFAOYSA-N |
| SMILES | C1CC1C2=NN(C(=C2)N)C3CCS(=O)(=O)C3 |
Computed by PubChem (NCBI)