Products 115299-07-5
CAS 115299-07-5 is the registry number for 2-(3-Methoxyphenyl)-1,3-thiazole-4-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 25g, 5g, 1g.
2-(3-methoxyphenyl)-1,3-thiazole-4-carboxylic acid (CAS 115299-07-5) is a chemical compound with the molecular formula C11H9NO3S and a molecular weight of 235.26 g/mol. IUPAC name: 2-(3-methoxyphenyl)-1,3-thiazole-4-carboxylic acid. InChIKey: AQWFWIIMHLYERJ-UHFFFAOYSA-N.
| Molecular formula | C11H9NO3S |
|---|---|
| Molecular weight | 235.26 g/mol |
| IUPAC name | 2-(3-methoxyphenyl)-1,3-thiazole-4-carboxylic acid |
| InChIKey | AQWFWIIMHLYERJ-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1)C2=NC(=CS2)C(=O)O |
Computed by PubChem (NCBI)