CAS 123971-42-6 is the registry number for 2-Thiazolecarboxylic acid, 4-(4-methoxyphenyl)-, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
4-(4-methoxyphenyl)-1,3-thiazole-2-carboxylic acid (CAS 123971-42-6) is a chemical compound with the molecular formula C11H9NO3S and a molecular weight of 235.26 g/mol. IUPAC name: 4-(4-methoxyphenyl)-1,3-thiazole-2-carboxylic acid. InChIKey: ZYQVZIBTYDJJHV-UHFFFAOYSA-N.
| Molecular formula | C11H9NO3S |
|---|---|
| Molecular weight | 235.26 g/mol |
| IUPAC name | 4-(4-methoxyphenyl)-1,3-thiazole-2-carboxylic acid |
| InChIKey | ZYQVZIBTYDJJHV-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=CSC(=N2)C(=O)O |
Computed by PubChem (NCBI)