CAS 56355-63-6 is the registry number for 4-Methyl-2-phenoxy-1,3-thiazole-5-carboxylic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
4-methyl-2-phenoxy-1,3-thiazole-5-carboxylic acid (CAS 56355-63-6) is a chemical compound with the molecular formula C11H9NO3S and a molecular weight of 235.26 g/mol. IUPAC name: 4-methyl-2-phenoxy-1,3-thiazole-5-carboxylic acid. InChIKey: FWGBDPRIFGAYIT-UHFFFAOYSA-N.
| Molecular formula | C11H9NO3S |
|---|---|
| Molecular weight | 235.26 g/mol |
| IUPAC name | 4-methyl-2-phenoxy-1,3-thiazole-5-carboxylic acid |
| InChIKey | FWGBDPRIFGAYIT-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)OC2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)