Products 133834-03-4

CAS 133834-03-4 is the registry number for 2-(4-Hydroxy-2-phenyl-1,3-thiazol-5-yl)acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.

Structural formula: {0} (CAS {1})

2-(4-hydroxy-2-phenyl-1,3-thiazol-5-yl)acetic acid (CAS 133834-03-4) is a chemical compound with the molecular formula C11H9NO3S and a molecular weight of 235.26 g/mol. IUPAC name: 2-(4-hydroxy-2-phenyl-1,3-thiazol-5-yl)acetic acid. InChIKey: NOTOFOSPABEIMC-UHFFFAOYSA-N.

Identity
Molecular formulaC11H9NO3S
Molecular weight235.26 g/mol
IUPAC name2-(4-hydroxy-2-phenyl-1,3-thiazol-5-yl)acetic acid
InChIKeyNOTOFOSPABEIMC-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)C2=NC(=C(S2)CC(=O)O)O

Computed by PubChem (NCBI)