Products 1153023-06-3
CAS 1153023-06-3 is the registry number for 1-(5-Bromothiophene-3-carbonyl)-4-methylpiperidine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
(5-bromothiophen-3-yl)-(4-methylpiperidin-1-yl)methanone (CAS 1153023-06-3) is a chemical compound with the molecular formula C11H14BrNOS and a molecular weight of 288.21 g/mol. IUPAC name: (5-bromothiophen-3-yl)-(4-methylpiperidin-1-yl)methanone. InChIKey: ZKOYSDRTZYGWCV-UHFFFAOYSA-N.
| Molecular formula | C11H14BrNOS |
|---|---|
| Molecular weight | 288.21 g/mol |
| IUPAC name | (5-bromothiophen-3-yl)-(4-methylpiperidin-1-yl)methanone |
| InChIKey | ZKOYSDRTZYGWCV-UHFFFAOYSA-N |
| SMILES | CC1CCN(CC1)C(=O)C2=CSC(=C2)Br |
Computed by PubChem (NCBI)