CAS 1250712-90-3 is the registry number for N-((4-Bromothiophen-2-yl)methyl)-N,3-dimethylbut-2-enamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-[(4-bromothiophen-2-yl)methyl]-N,3-dimethylbut-2-enamide (CAS 1250712-90-3) is a chemical compound with the molecular formula C11H14BrNOS and a molecular weight of 288.21 g/mol. IUPAC name: N-[(4-bromothiophen-2-yl)methyl]-N,3-dimethylbut-2-enamide. InChIKey: WHPHGKJJXNGHFC-UHFFFAOYSA-N.
| Molecular formula | C11H14BrNOS |
|---|---|
| Molecular weight | 288.21 g/mol |
| IUPAC name | N-[(4-bromothiophen-2-yl)methyl]-N,3-dimethylbut-2-enamide |
| InChIKey | WHPHGKJJXNGHFC-UHFFFAOYSA-N |
| SMILES | CC(=CC(=O)N(C)CC1=CC(=CS1)Br)C |
Computed by PubChem (NCBI)