CAS 856562-51-1 is the registry number for (S,E)-N-(4-Bromobenzylidene)-2-methylpropane-2-sulfinamide, 97%. Offered by: Ambeed. Available pack sizes: 250mg, 1g, 5g.
(S)-N-[(4-bromophenyl)methylidene]-2-methylpropane-2-sulfinamide (CAS 856562-51-1) is a chemical compound with the molecular formula C11H14BrNOS and a molecular weight of 288.21 g/mol. IUPAC name: (S)-N-[(4-bromophenyl)methylidene]-2-methylpropane-2-sulfinamide. InChIKey: LDRVYZUIUHRGAW-HNNXBMFYSA-N.
| Molecular formula | C11H14BrNOS |
|---|---|
| Molecular weight | 288.21 g/mol |
| IUPAC name | (S)-N-[(4-bromophenyl)methylidene]-2-methylpropane-2-sulfinamide |
| InChIKey | LDRVYZUIUHRGAW-HNNXBMFYSA-N |
| SMILES | CC(C)(C)[S@](=O)N=CC1=CC=C(C=C1)Br |
Computed by PubChem (NCBI)