CAS 3026511-80-5 appears in our catalog under these names: 1-((4-Bromo-2-methylphenyl)imino)tetrahydro-1H-1l6-thiophene 1-oxide, 95%, 95%, 1-((4-Bromo-2-methylphenyl)imino)tetrahydro-1H-1l6-thiophene 1-oxide, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
1-(4-bromo-2-methylphenyl)iminothiolane 1-oxide (CAS 3026511-80-5) is a chemical compound with the molecular formula C11H14BrNOS and a molecular weight of 288.21 g/mol. IUPAC name: 1-(4-bromo-2-methylphenyl)iminothiolane 1-oxide. InChIKey: IJWXRKLXIHFEAB-UHFFFAOYSA-N.
| Molecular formula | C11H14BrNOS |
|---|---|
| Molecular weight | 288.21 g/mol |
| IUPAC name | 1-(4-bromo-2-methylphenyl)iminothiolane 1-oxide |
| InChIKey | IJWXRKLXIHFEAB-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)Br)N=S2(=O)CCCC2 |
Computed by PubChem (NCBI)