CAS 1153389-79-7 is the registry number for N-(4-(Pyrrolidine-1-sulfonyl)phenyl)prop-2-enamide, 98%. Offered by: AmBeed. Available pack sizes: 1g.
N-(4-pyrrolidin-1-ylsulfonylphenyl)prop-2-enamide (CAS 1153389-79-7) is a chemical compound with the molecular formula C13H16N2O3S and a molecular weight of 280.34 g/mol. IUPAC name: N-(4-pyrrolidin-1-ylsulfonylphenyl)prop-2-enamide. InChIKey: YWRDIVXHYHFOLT-UHFFFAOYSA-N.
| Molecular formula | C13H16N2O3S |
|---|---|
| Molecular weight | 280.34 g/mol |
| IUPAC name | N-(4-pyrrolidin-1-ylsulfonylphenyl)prop-2-enamide |
| InChIKey | YWRDIVXHYHFOLT-UHFFFAOYSA-N |
| SMILES | C=CC(=O)NC1=CC=C(C=C1)S(=O)(=O)N2CCCC2 |
Computed by PubChem (NCBI)