CAS 349623-66-1 is the registry number for (5-methylisoxazol-3-yl)((2,4,6-trimethylphenyl)sulfonyl)amine. Offered by: Biosynth. Available pack sizes: 250mg.
2,4,6-trimethyl-N-(5-methyl-1,2-oxazol-3-yl)benzenesulfonamide (CAS 349623-66-1) is a chemical compound with the molecular formula C13H16N2O3S and a molecular weight of 280.34 g/mol. IUPAC name: 2,4,6-trimethyl-N-(5-methyl-1,2-oxazol-3-yl)benzenesulfonamide. InChIKey: CEWJFUKOFXOALB-UHFFFAOYSA-N.
| Molecular formula | C13H16N2O3S |
|---|---|
| Molecular weight | 280.34 g/mol |
| IUPAC name | 2,4,6-trimethyl-N-(5-methyl-1,2-oxazol-3-yl)benzenesulfonamide |
| InChIKey | CEWJFUKOFXOALB-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)S(=O)(=O)NC2=NOC(=C2)C)C |
Computed by PubChem (NCBI)