CAS 1643147-60-7 appears in our catalog under these names: Benzyl 2-imino-2l6-thia-6-azaspiro[3.3]heptane-6-carboxylate 2-oxide, 98%, Benzyl 2-imino-2λ6-thia-6-azaspiro[3.3]heptane-6-carboxylate 2-oxide, 95%, 95%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 100mg, 250mg, 1g.
Benzyl 2-imino-2-oxo-2lambda6-thia-6-azaspiro[3.3]heptane-6-carboxylate (CAS 1643147-60-7) is a chemical compound with the molecular formula C13H16N2O3S and a molecular weight of 280.34 g/mol. IUPAC name: benzyl 2-imino-2-oxo-2lambda6-thia-6-azaspiro[3.3]heptane-6-carboxylate. InChIKey: DBPWCTYDDLRNLS-UHFFFAOYSA-N.
| Molecular formula | C13H16N2O3S |
|---|---|
| Molecular weight | 280.34 g/mol |
| IUPAC name | benzyl 2-imino-2-oxo-2lambda6-thia-6-azaspiro[3.3]heptane-6-carboxylate |
| InChIKey | DBPWCTYDDLRNLS-UHFFFAOYSA-N |
| SMILES | C1C2(CN1C(=O)OCC3=CC=CC=C3)CS(=N)(=O)C2 |
Computed by PubChem (NCBI)