Products 899446-83-4
CAS 899446-83-4 is the registry number for 5-(Piperidine-1-sulfonyl)oxindole, 98%. Offered by: Combi-blocks. Available pack sizes: 250mg, 100mg.
5-piperidin-1-ylsulfonyl-1,3-dihydroindol-2-one (CAS 899446-83-4) is a chemical compound with the molecular formula C13H16N2O3S and a molecular weight of 280.34 g/mol. IUPAC name: 5-piperidin-1-ylsulfonyl-1,3-dihydroindol-2-one. InChIKey: XCCYNFNWKCGRRA-UHFFFAOYSA-N.
| Molecular formula | C13H16N2O3S |
|---|---|
| Molecular weight | 280.34 g/mol |
| IUPAC name | 5-piperidin-1-ylsulfonyl-1,3-dihydroindol-2-one |
| InChIKey | XCCYNFNWKCGRRA-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)S(=O)(=O)C2=CC3=C(C=C2)NC(=O)C3 |
Computed by PubChem (NCBI)