CAS 115339-34-9 is the registry number for 2-Chloro-4-acetamido-6-amino-s-triazine. Offered by: TRC. Available pack sizes: 500mg.
N-(4-amino-6-chloro-1,3,5-triazin-2-yl)acetamide (CAS 115339-34-9) is a chemical compound with the molecular formula C5H6ClN5O and a molecular weight of 187.59 g/mol. IUPAC name: N-(4-amino-6-chloro-1,3,5-triazin-2-yl)acetamide. InChIKey: JZDAHZAVLYDAFN-UHFFFAOYSA-N.
| Molecular formula | C5H6ClN5O |
|---|---|
| Molecular weight | 187.59 g/mol |
| IUPAC name | N-(4-amino-6-chloro-1,3,5-triazin-2-yl)acetamide |
| InChIKey | JZDAHZAVLYDAFN-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=NC(=NC(=N1)N)Cl |
Computed by PubChem (NCBI)