CAS 14236-57-8 appears in our catalog under these names: 6–Chloro–3,5–diamino–2–pyrazinecarboxamide, 3,5-Diamino-6-chloropyrazine-2-carboxamide, ≥98%, ≥98%, 3,5-Diamino-6-chloropyrazine-2-carboxamide, 98%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 2,5g, 250mg, 50mg, 500mg.
3,5-diamino-6-chloropyrazine-2-carboxamide (CAS 14236-57-8) is a chemical compound with the molecular formula C5H6ClN5O and a molecular weight of 187.59 g/mol. IUPAC name: 3,5-diamino-6-chloropyrazine-2-carboxamide. InChIKey: UYTQEWLAYXCJEC-UHFFFAOYSA-N.
| Molecular formula | C5H6ClN5O |
|---|---|
| Molecular weight | 187.59 g/mol |
| IUPAC name | 3,5-diamino-6-chloropyrazine-2-carboxamide |
| InChIKey | UYTQEWLAYXCJEC-UHFFFAOYSA-N |
| SMILES | C1(=C(N=C(C(=N1)Cl)N)N)C(=O)N |
Computed by PubChem (NCBI)