CAS 1803584-80-6 is the registry number for 6-Chloro-2-N-methyl-5-nitrosopyrimidine-2,4-diamine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
6-chloro-2-N-methyl-5-nitrosopyrimidine-2,4-diamine (CAS 1803584-80-6) is a chemical compound with the molecular formula C5H6ClN5O and a molecular weight of 187.59 g/mol. IUPAC name: 6-chloro-2-N-methyl-5-nitrosopyrimidine-2,4-diamine. InChIKey: YANVWYYLMGJGON-UHFFFAOYSA-N.
| Molecular formula | C5H6ClN5O |
|---|---|
| Molecular weight | 187.59 g/mol |
| IUPAC name | 6-chloro-2-N-methyl-5-nitrosopyrimidine-2,4-diamine |
| InChIKey | YANVWYYLMGJGON-UHFFFAOYSA-N |
| SMILES | CNC1=NC(=C(C(=N1)Cl)N=O)N |
Computed by PubChem (NCBI)